C17H15NO6 — CID 2510669
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methoxybenzoate (PubChem CID 2510669) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2510669 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H15NO6/c1-21-13-5-2-11(3-6-13)17(20)22-9-16(19)18-12-4-7-14-15(8-12)24-10-23-14/h2-8H,9-10H2,1H3,(H,18,19) |
| InChIKey | SPCDQAVRFQQUOT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |