C21H23NO6 — CID 2605671
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-pentoxybenzoate (PubChem CID 2605671) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-pentoxybenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 2605671 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-2-3-4-11-25-17-8-5-15(6-9-17)21(24)26-13-20(23)22-16-7-10-18-19(12-16)28-14-27-18/h5-10,12H,2-4,11,13-14H2,1H3,(H,22,23) |
| InChIKey | YYEUKDSZSDVGGX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|