C26H27N3O4 — CID 3884549
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-pentoxybenzoate (PubChem CID 3884549) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-pentoxybenzoate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 3884549 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)OCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-2-3-7-18-32-24-16-10-20(11-17-24)26(31)33-19-25(30)27-21-12-14-23(15-13-21)29-28-22-8-5-4-6-9-22/h4-6,8-17H,2-3,7,18-19H2,1H3,(H,27,30)/b29-28+ |
| InChIKey | BKXUGAULVIPQRU-ZQHSETAFSA-N |
| XLogP | 6.47 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|