C48H54N4O6 — CID 101088132
[2-[4-[(4-octoxyphenyl)diazenyl]benzoyl]oxyphenyl] 4-[(4-octoxyphenyl)diazenyl]benzoate (PubChem CID 101088132) has the molecular formula C48H54N4O6 and a molecular weight of 782.98 g/mol. Its IUPAC name is [2-[4-[(4-octoxyphenyl)diazenyl]benzoyl]oxyphenyl] 4-[(4-octoxyphenyl)diazenyl]benzoate.
| Compound Name | [2-[4-[(4-octoxyphenyl)diazenyl]benzoyl]oxyphenyl] 4-[(4-octoxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 101088132 |
| Molecular Formula | C48H54N4O6 |
| Molecular Weight | 782.98 g/mol |
| Exact Mass | 782.40 |
| IUPAC Name | [2-[4-[(4-octoxyphenyl)diazenyl]benzoyl]oxyphenyl] 4-[(4-octoxyphenyl)diazenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)Oc3ccccc3OC(=O)c3ccc(/N=N/c4ccc(OCCCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H54N4O6/c1-3-5-7-9-11-15-35-55-43-31-27-41(28-32-43)51-49-39-23-19-37(20-24-39)47(53)57-45-17-13-14-18-46(45)58-48(54)38-21-25-40(26-22-38)50-52-42-29-33-44(34-30-42)56-36-16-12-10-8-6-4-2/h13-14,17-34H,3-12,15-16,35-36H2,1-2H3/b51-49+,52-50+ |
| InChIKey | YTHMLXCARHNRIA-BILXIUEVSA-N |
| XLogP | 14.43 |
| TPSA | 120.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.98 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|