C35H36F2N4O3 — CID 132552787
[2-fluoro-4-[(2-fluorophenyl)diazenyl]phenyl] 4-[(4-decoxyphenyl)diazenyl]benzoate (PubChem CID 132552787) has the molecular formula C35H36F2N4O3 and a molecular weight of 598.69 g/mol. Its IUPAC name is [2-fluoro-4-[(2-fluorophenyl)diazenyl]phenyl] 4-[(4-decoxyphenyl)diazenyl]benzoate.
| Compound Name | [2-fluoro-4-[(2-fluorophenyl)diazenyl]phenyl] 4-[(4-decoxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 132552787 |
| Molecular Formula | C35H36F2N4O3 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | [2-fluoro-4-[(2-fluorophenyl)diazenyl]phenyl] 4-[(4-decoxyphenyl)diazenyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)Oc3ccc(/N=N/c4ccccc4F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C35H36F2N4O3/c1-2-3-4-5-6-7-8-11-24-43-30-21-18-28(19-22-30)39-38-27-16-14-26(15-17-27)35(42)44-34-23-20-29(25-32(34)37)40-41-33-13-10-9-12-31(33)36/h9-10,12-23,25H,2-8,11,24H2,1H3/b39-38+,41-40+ |
| InChIKey | XIOXKWVEUWGFMG-VJETXLNASA-N |
| XLogP | 11.53 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|