C28H32N2O3 — CID 102265286
(2-methyl-4-phenyldiazenylphenyl) 4-octoxybenzoate (PubChem CID 102265286) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is (2-methyl-4-phenyldiazenylphenyl) 4-octoxybenzoate.
| Compound Name | (2-methyl-4-phenyldiazenylphenyl) 4-octoxybenzoate |
|---|---|
| PubChem CID | 102265286 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (2-methyl-4-phenyldiazenylphenyl) 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-3-4-5-6-7-11-20-32-26-17-14-23(15-18-26)28(31)33-27-19-16-25(21-22(27)2)30-29-24-12-9-8-10-13-24/h8-10,12-19,21H,3-7,11,20H2,1-2H3/b30-29+ |
| InChIKey | JEUXOMWLQPGAKR-QVIHXGFCSA-N |
| XLogP | 8.37 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|