C35H40N2O4 — CID 132573524
[4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl] 4-heptoxybenzoate (PubChem CID 132573524) has the molecular formula C35H40N2O4 and a molecular weight of 552.72 g/mol. Its IUPAC name is [4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl] 4-heptoxybenzoate.
| Compound Name | [4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 132573524 |
| Molecular Formula | C35H40N2O4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | [4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(OCCCCC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C35H40N2O4/c1-3-5-7-8-12-26-40-29-19-15-27(16-20-29)35(38)41-34-24-23-33(31-13-9-10-14-32(31)34)37-36-28-17-21-30(22-18-28)39-25-11-6-4-2/h9-10,13-24H,3-8,11-12,25-26H2,1-2H3/b37-36+ |
| InChIKey | JRDMKHMJTYHAFQ-BSRQYYOTSA-N |
| XLogP | 10.39 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|