C31H34N4O — CID 58556728
(4-butylphenyl)-[4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl]diazene (PubChem CID 58556728) has the molecular formula C31H34N4O and a molecular weight of 478.64 g/mol. Its IUPAC name is (4-butylphenyl)-[4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl]diazene.
| Compound Name | (4-butylphenyl)-[4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl]diazene |
|---|---|
| PubChem CID | 58556728 |
| Molecular Formula | C31H34N4O |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (4-butylphenyl)-[4-[(4-pentoxyphenyl)diazenyl]naphthalen-1-yl]diazene |
| SMILES | CCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(CCCC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H34N4O/c1-3-5-9-23-36-27-19-17-26(18-20-27)33-35-31-22-21-30(28-11-7-8-12-29(28)31)34-32-25-15-13-24(14-16-25)10-6-4-2/h7-8,11-22H,3-6,9-10,23H2,1-2H3/b34-32+,35-33+ |
| InChIKey | STKRBGOHNKKYNI-XUXOKTBYSA-N |
| XLogP | 10.58 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|