C24H33ClN2O — CID 2753424
(4-butylphenyl)-(2-chloro-4-octoxyphenyl)diazene (PubChem CID 2753424) has the molecular formula C24H33ClN2O and a molecular weight of 400.99 g/mol. Its IUPAC name is (4-butylphenyl)-(2-chloro-4-octoxyphenyl)diazene.
| Compound Name | (4-butylphenyl)-(2-chloro-4-octoxyphenyl)diazene |
|---|---|
| PubChem CID | 2753424 |
| Molecular Formula | C24H33ClN2O |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (4-butylphenyl)-(2-chloro-4-octoxyphenyl)diazene |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2ccc(CCCC)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H33ClN2O/c1-3-5-7-8-9-10-18-28-22-16-17-24(23(25)19-22)27-26-21-14-12-20(13-15-21)11-6-4-2/h12-17,19H,3-11,18H2,1-2H3/b27-26+ |
| InChIKey | WXSMFGPMXVJXLJ-CYYJNZCTSA-N |
| XLogP | 8.84 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|