C27H28ClFN2O3 — CID 102345235
[3-chloro-4-[(4-fluorophenyl)diazenyl]phenyl] 4-octoxybenzoate (PubChem CID 102345235) has the molecular formula C27H28ClFN2O3 and a molecular weight of 482.98 g/mol. Its IUPAC name is [3-chloro-4-[(4-fluorophenyl)diazenyl]phenyl] 4-octoxybenzoate.
| Compound Name | [3-chloro-4-[(4-fluorophenyl)diazenyl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 102345235 |
| Molecular Formula | C27H28ClFN2O3 |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [3-chloro-4-[(4-fluorophenyl)diazenyl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(F)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H28ClFN2O3/c1-2-3-4-5-6-7-18-33-23-14-8-20(9-15-23)27(32)34-24-16-17-26(25(28)19-24)31-30-22-12-10-21(29)11-13-22/h8-17,19H,2-7,18H2,1H3/b31-30+ |
| InChIKey | AFXFQGBFWRGNGK-NVQSTNCTSA-N |
| XLogP | 8.85 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|