C62H72N6O12 — CID 102582532
[3-[4-[5-(4-decoxybenzoyl)oxy-2-[(4-nitrophenyl)diazenyl]phenoxy]butoxy]-4-[(4-nitrophenyl)diazenyl]phenyl] 4-decoxybenzoate (PubChem CID 102582532) has the molecular formula C62H72N6O12 and a molecular weight of 1093.29 g/mol. Its IUPAC name is [3-[4-[5-(4-decoxybenzoyl)oxy-2-[(4-nitrophenyl)diazenyl]phenoxy]butoxy]-4-[(4-nitrophenyl)diazenyl]phenyl] 4-decoxybenzoate.
| Compound Name | [3-[4-[5-(4-decoxybenzoyl)oxy-2-[(4-nitrophenyl)diazenyl]phenoxy]butoxy]-4-[(4-nitrophenyl)diazenyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 102582532 |
| Molecular Formula | C62H72N6O12 |
| Molecular Weight | 1093.29 g/mol |
| Exact Mass | 1092.52 |
| IUPAC Name | [3-[4-[5-(4-decoxybenzoyl)oxy-2-[(4-nitrophenyl)diazenyl]phenoxy]butoxy]-4-[(4-nitrophenyl)diazenyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)c(OCCCCOc3cc(OC(=O)c4ccc(OCCCCCCCCCC)cc4)ccc3/N=N/c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C62H72N6O12/c1-3-5-7-9-11-13-15-17-41-75-53-33-21-47(22-34-53)61(69)79-55-37-39-57(65-63-49-25-29-51(30-26-49)67(71)72)59(45-55)77-43-19-20-44-78-60-46-56(38-40-58(60)66-64-50-27-31-52(32-28-50)68(73)74)80-62(70)48-23-35-54(36-24-48)76-42-18-16-14-12-10-8-6-4-2/h21-40,45-46H,3-20,41-44H2,1-2H3/b65-63+,66-64+ |
| InChIKey | HVUMCHFZTZAOFY-QSPQIQFQSA-N |
| XLogP | 18.05 |
| TPSA | 225.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.29 |
| LogP ≤ 5 | 18.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|