C39H42N2O8 — CID 102385180
[4-(4-hexoxybenzoyl)oxy-3-[(4-nitrophenyl)iminomethyl]phenyl] 4-hexoxybenzoate (PubChem CID 102385180) has the molecular formula C39H42N2O8 and a molecular weight of 666.77 g/mol. Its IUPAC name is [4-(4-hexoxybenzoyl)oxy-3-[(4-nitrophenyl)iminomethyl]phenyl] 4-hexoxybenzoate.
| Compound Name | [4-(4-hexoxybenzoyl)oxy-3-[(4-nitrophenyl)iminomethyl]phenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 102385180 |
| Molecular Formula | C39H42N2O8 |
| Molecular Weight | 666.77 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | [4-(4-hexoxybenzoyl)oxy-3-[(4-nitrophenyl)iminomethyl]phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCC)cc3)c(/C=N/c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C39H42N2O8/c1-3-5-7-9-25-46-34-19-11-29(12-20-34)38(42)48-36-23-24-37(31(27-36)28-40-32-15-17-33(18-16-32)41(44)45)49-39(43)30-13-21-35(22-14-30)47-26-10-8-6-4-2/h11-24,27-28H,3-10,25-26H2,1-2H3/b40-28+ |
| InChIKey | YMYFEDXJOSYBGY-JFXHSDHMSA-N |
| XLogP | 9.70 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.77 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|