C36H34F3NO6 — CID 102385173
[4-(4-butoxybenzoyl)oxy-3-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl] 4-butoxybenzoate (PubChem CID 102385173) has the molecular formula C36H34F3NO6 and a molecular weight of 633.66 g/mol. Its IUPAC name is [4-(4-butoxybenzoyl)oxy-3-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-(4-butoxybenzoyl)oxy-3-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 102385173 |
| Molecular Formula | C36H34F3NO6 |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | [4-(4-butoxybenzoyl)oxy-3-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC)cc3)c(/C=N/c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C36H34F3NO6/c1-3-5-21-43-30-15-7-25(8-16-30)34(41)45-32-19-20-33(46-35(42)26-9-17-31(18-10-26)44-22-6-4-2)27(23-32)24-40-29-13-11-28(12-14-29)36(37,38)39/h7-20,23-24H,3-6,21-22H2,1-2H3/b40-24+ |
| InChIKey | GJEWVXGAAOIMFV-BKATUZMVSA-N |
| XLogP | 9.25 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|