C28H30ClNO4 — CID 136694215
[4-[(4-chlorophenyl)iminomethyl]-3-hydroxyphenyl] 4-octoxybenzoate (PubChem CID 136694215) has the molecular formula C28H30ClNO4 and a molecular weight of 480.00 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)iminomethyl]-3-hydroxyphenyl] 4-octoxybenzoate.
| Compound Name | [4-[(4-chlorophenyl)iminomethyl]-3-hydroxyphenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 136694215 |
| Molecular Formula | C28H30ClNO4 |
| Molecular Weight | 480.00 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [4-[(4-chlorophenyl)iminomethyl]-3-hydroxyphenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(Cl)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C28H30ClNO4/c1-2-3-4-5-6-7-18-33-25-15-8-21(9-16-25)28(32)34-26-17-10-22(27(31)19-26)20-30-24-13-11-23(29)12-14-24/h8-17,19-20,31H,2-7,18H2,1H3/b30-20+ |
| InChIKey | ASKQJHHTIZPPQY-TWKHWXDSSA-N |
| XLogP | 7.75 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.00 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|