C28H31NO5 — CID 136746724
[3-hydroxy-4-[(2-hydroxyphenyl)iminomethyl]phenyl] 4-octoxybenzoate (PubChem CID 136746724) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is [3-hydroxy-4-[(2-hydroxyphenyl)iminomethyl]phenyl] 4-octoxybenzoate.
| Compound Name | [3-hydroxy-4-[(2-hydroxyphenyl)iminomethyl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 136746724 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [3-hydroxy-4-[(2-hydroxyphenyl)iminomethyl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccccc3O)c(O)c2)cc1 |
| InChI | InChI=1S/C28H31NO5/c1-2-3-4-5-6-9-18-33-23-15-12-21(13-16-23)28(32)34-24-17-14-22(27(31)19-24)20-29-25-10-7-8-11-26(25)30/h7-8,10-17,19-20,30-31H,2-6,9,18H2,1H3/b29-20+ |
| InChIKey | KIBCOEUJTJDUCG-ZTKZIYFRSA-N |
| XLogP | 6.81 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|