C25H25NO5 — CID 136746703
[3-hydroxy-4-[(4-hydroxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate (PubChem CID 136746703) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [3-hydroxy-4-[(4-hydroxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate.
| Compound Name | [3-hydroxy-4-[(4-hydroxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 136746703 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [3-hydroxy-4-[(4-hydroxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(O)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-2-3-4-15-30-22-12-5-18(6-13-22)25(29)31-23-14-7-19(24(28)16-23)17-26-20-8-10-21(27)11-9-20/h5-14,16-17,27-28H,2-4,15H2,1H3/b26-17+ |
| InChIKey | BNUQGBDALQVASO-YZSQISJMSA-N |
| XLogP | 5.64 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|