C26H24N2O4 — CID 136738093
[4-[(4-cyanophenyl)iminomethyl]-3-hydroxyphenyl] 4-pentoxybenzoate (PubChem CID 136738093) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [4-[(4-cyanophenyl)iminomethyl]-3-hydroxyphenyl] 4-pentoxybenzoate.
| Compound Name | [4-[(4-cyanophenyl)iminomethyl]-3-hydroxyphenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 136738093 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [4-[(4-cyanophenyl)iminomethyl]-3-hydroxyphenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(C#N)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-2-3-4-15-31-23-12-7-20(8-13-23)26(30)32-24-14-9-21(25(29)16-24)18-28-22-10-5-19(17-27)6-11-22/h5-14,16,18,29H,2-4,15H2,1H3/b28-18+ |
| InChIKey | QNFKKFONZIQLBI-MTDXEUNCSA-N |
| XLogP | 5.80 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|