C28H31NO4 — CID 136734504
[3-hydroxy-4-[(4-methylphenyl)iminomethyl]phenyl] 4-heptoxybenzoate (PubChem CID 136734504) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [3-hydroxy-4-[(4-methylphenyl)iminomethyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [3-hydroxy-4-[(4-methylphenyl)iminomethyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 136734504 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [3-hydroxy-4-[(4-methylphenyl)iminomethyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(C)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-3-4-5-6-7-18-32-25-15-10-22(11-16-25)28(31)33-26-17-12-23(27(30)19-26)20-29-24-13-8-21(2)9-14-24/h8-17,19-20,30H,3-7,18H2,1-2H3/b29-20+ |
| InChIKey | YXJZYYJUIHPYFR-ZTKZIYFRSA-N |
| XLogP | 7.02 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|