C49H54N2O8 — CID 136832881
[3-[4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoyl]oxy-2-methylphenyl] 4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoate (PubChem CID 136832881) has the molecular formula C49H54N2O8 and a molecular weight of 798.98 g/mol. Its IUPAC name is [3-[4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoyl]oxy-2-methylphenyl] 4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoate.
| Compound Name | [3-[4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoyl]oxy-2-methylphenyl] 4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 136832881 |
| Molecular Formula | C49H54N2O8 |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.39 |
| IUPAC Name | [3-[4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoyl]oxy-2-methylphenyl] 4-[(4-heptoxy-2-hydroxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/N=C/c5ccc(OCCCCCCC)cc5O)cc4)c3C)cc2)c(O)c1 |
| InChI | InChI=1S/C49H54N2O8/c1-4-6-8-10-12-29-56-42-27-21-38(44(52)31-42)33-50-40-23-17-36(18-24-40)48(54)58-46-15-14-16-47(35(46)3)59-49(55)37-19-25-41(26-20-37)51-34-39-22-28-43(32-45(39)53)57-30-13-11-9-7-5-2/h14-28,31-34,52-53H,4-13,29-30H2,1-3H3/b50-33+,51-34+ |
| InChIKey | BZIHVPGNEZWDQG-RVQUVCRGSA-N |
| XLogP | 12.04 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|