C44H44N2O8 — CID 136879525
[2-[4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoate (PubChem CID 136879525) has the molecular formula C44H44N2O8 and a molecular weight of 728.84 g/mol. Its IUPAC name is [2-[4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoate.
| Compound Name | [2-[4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 136879525 |
| Molecular Formula | C44H44N2O8 |
| Molecular Weight | 728.84 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | [2-[4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoyl]oxyphenyl] 4-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCOc1ccc(/C=N/c2ccc(C(=O)Oc3ccccc3OC(=O)c3ccc(/N=C/c4ccc(OCCCCC)cc4O)cc3)cc2)c(O)c1 |
| InChI | InChI=1S/C44H44N2O8/c1-3-5-9-25-51-37-23-17-33(39(47)27-37)29-45-35-19-13-31(14-20-35)43(49)53-41-11-7-8-12-42(41)54-44(50)32-15-21-36(22-16-32)46-30-34-18-24-38(28-40(34)48)52-26-10-6-4-2/h7-8,11-24,27-30,47-48H,3-6,9-10,25-26H2,1-2H3/b45-29+,46-30+ |
| InChIKey | YZXQISRZESNPBD-PGZMIIDGSA-N |
| XLogP | 10.18 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.84 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|