C26H27NO5 — CID 136834355
[3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate (PubChem CID 136834355) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is [3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate.
| Compound Name | [3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 136834355 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(OC)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-3-4-5-16-31-23-11-6-19(7-12-23)26(29)32-24-13-8-20(25(28)17-24)18-27-21-9-14-22(30-2)15-10-21/h6-15,17-18,28H,3-5,16H2,1-2H3/b27-18+ |
| InChIKey | QNYZLIWYOJKJON-OVVQPSECSA-N |
| XLogP | 5.94 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|