C78H93N3O12 — CID 136801755
[4-[[3,4-bis[[4-(4-decoxybenzoyl)oxy-2-hydroxyphenyl]methylideneamino]phenyl]iminomethyl]-3-hydroxyphenyl] 4-decoxybenzoate (PubChem CID 136801755) has the molecular formula C78H93N3O12 and a molecular weight of 1264.61 g/mol. Its IUPAC name is [4-[[3,4-bis[[4-(4-decoxybenzoyl)oxy-2-hydroxyphenyl]methylideneamino]phenyl]iminomethyl]-3-hydroxyphenyl] 4-decoxybenzoate.
| Compound Name | [4-[[3,4-bis[[4-(4-decoxybenzoyl)oxy-2-hydroxyphenyl]methylideneamino]phenyl]iminomethyl]-3-hydroxyphenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 136801755 |
| Molecular Formula | C78H93N3O12 |
| Molecular Weight | 1264.61 g/mol |
| Exact Mass | 1263.68 |
| IUPAC Name | [4-[[3,4-bis[[4-(4-decoxybenzoyl)oxy-2-hydroxyphenyl]methylideneamino]phenyl]iminomethyl]-3-hydroxyphenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(/N=C/c4ccc(OC(=O)c5ccc(OCCCCCCCCCC)cc5)cc4O)c(/N=C/c4ccc(OC(=O)c5ccc(OCCCCCCCCCC)cc5)cc4O)c3)c(O)c2)cc1 |
| InChI | InChI=1S/C78H93N3O12/c1-4-7-10-13-16-19-22-25-48-88-65-38-28-58(29-39-65)76(85)91-68-44-34-61(73(82)52-68)55-79-64-37-47-71(80-56-62-35-45-69(53-74(62)83)92-77(86)59-30-40-66(41-31-59)89-49-26-23-20-17-14-11-8-5-2)72(51-64)81-57-63-36-46-70(54-75(63)84)93-78(87)60-32-42-67(43-33-60)90-50-27-24-21-18-15-12-9-6-3/h28-47,51-57,82-84H,4-27,48-50H2,1-3H3/b79-55+,80-56+,81-57+ |
| InChIKey | UNIAYNFOJYSBHA-FYJBUULCSA-N |
| XLogP | 20.27 |
| TPSA | 204.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1264.61 |
| LogP ≤ 5 | 20.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|