C31H45NO4 — CID 136721038
[4-(heptyliminomethyl)-3-hydroxyphenyl] 4-decoxybenzoate (PubChem CID 136721038) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is [4-(heptyliminomethyl)-3-hydroxyphenyl] 4-decoxybenzoate.
| Compound Name | [4-(heptyliminomethyl)-3-hydroxyphenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 136721038 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | [4-(heptyliminomethyl)-3-hydroxyphenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/CCCCCCC)c(O)c2)cc1 |
| InChI | InChI=1S/C31H45NO4/c1-3-5-7-9-10-11-13-15-23-35-28-19-16-26(17-20-28)31(34)36-29-21-18-27(30(33)24-29)25-32-22-14-12-8-6-4-2/h16-21,24-25,33H,3-15,22-23H2,1-2H3/b32-25+ |
| InChIKey | MQABUIKUIJYJGX-WGPBWIAQSA-N |
| XLogP | 8.52 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|