C19H31NO2 — CID 136673235
5-hexoxy-2-(hexyliminomethyl)phenol (PubChem CID 136673235) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 5-hexoxy-2-(hexyliminomethyl)phenol.
| Compound Name | 5-hexoxy-2-(hexyliminomethyl)phenol |
|---|---|
| PubChem CID | 136673235 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 5-hexoxy-2-(hexyliminomethyl)phenol |
| SMILES | CCCCCC/N=C/c1ccc(OCCCCCC)cc1O |
| InChI | InChI=1S/C19H31NO2/c1-3-5-7-9-13-20-16-17-11-12-18(15-19(17)21)22-14-10-8-6-4-2/h11-12,15-16,21H,3-10,13-14H2,1-2H3/b20-16+ |
| InChIKey | PFDQAYNJKRBKAW-CAPFRKAQSA-N |
| XLogP | 5.35 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|