C16H25NO3 — CID 136798789
5-hexoxy-2-(3-hydroxypropyliminomethyl)phenol (PubChem CID 136798789) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-hexoxy-2-(3-hydroxypropyliminomethyl)phenol.
| Compound Name | 5-hexoxy-2-(3-hydroxypropyliminomethyl)phenol |
|---|---|
| PubChem CID | 136798789 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 5-hexoxy-2-(3-hydroxypropyliminomethyl)phenol |
| SMILES | CCCCCCOc1ccc(/C=N/CCCO)c(O)c1 |
| InChI | InChI=1S/C16H25NO3/c1-2-3-4-5-11-20-15-8-7-14(16(19)12-15)13-17-9-6-10-18/h7-8,12-13,18-19H,2-6,9-11H2,1H3/b17-13+ |
| InChIKey | PRKPTMIZGGFGEG-GHRIWEEISA-N |
| XLogP | 3.15 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|