C40H54N2O3 — CID 136746193
4-[4-[10-[4-(decyliminomethyl)-3-hydroxyphenoxy]decoxy]phenyl]benzonitrile (PubChem CID 136746193) has the molecular formula C40H54N2O3 and a molecular weight of 610.88 g/mol. Its IUPAC name is 4-[4-[10-[4-(decyliminomethyl)-3-hydroxyphenoxy]decoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[10-[4-(decyliminomethyl)-3-hydroxyphenoxy]decoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 136746193 |
| Molecular Formula | C40H54N2O3 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | 4-[4-[10-[4-(decyliminomethyl)-3-hydroxyphenoxy]decoxy]phenyl]benzonitrile |
| SMILES | CCCCCCCCCC/N=C/c1ccc(OCCCCCCCCCCOc2ccc(-c3ccc(C#N)cc3)cc2)cc1O |
| InChI | InChI=1S/C40H54N2O3/c1-2-3-4-5-6-9-12-15-28-42-33-37-24-27-39(31-40(37)43)45-30-17-14-11-8-7-10-13-16-29-44-38-25-22-36(23-26-38)35-20-18-34(32-41)19-21-35/h18-27,31,33,43H,2-17,28-30H2,1H3/b42-33+ |
| InChIKey | RFULHOFLFKOKEK-JBXJJHIASA-N |
| XLogP | 11.07 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|