C17H28N2O3 — CID 136808055
5-hexoxy-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol (PubChem CID 136808055) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 5-hexoxy-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol.
| Compound Name | 5-hexoxy-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 136808055 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 5-hexoxy-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol |
| SMILES | CCCCCCOc1ccc(/C=N/CCNCCO)c(O)c1 |
| InChI | InChI=1S/C17H28N2O3/c1-2-3-4-5-12-22-16-7-6-15(17(21)13-16)14-19-9-8-18-10-11-20/h6-7,13-14,18,20-21H,2-5,8-12H2,1H3/b19-14+ |
| InChIKey | CPFGBEVEVDKEJQ-XMHGGMMESA-N |
| XLogP | 2.35 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|