C23H26N4O4 — CID 177478269
[3-hydroxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] 4-heptoxybenzoate (PubChem CID 177478269) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is [3-hydroxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [3-hydroxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 177478269 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [3-hydroxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/n3cnnc3)c(O)c2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-2-3-4-5-6-13-30-20-10-7-18(8-11-20)23(29)31-21-12-9-19(22(28)14-21)15-26-27-16-24-25-17-27/h7-12,14-17,28H,2-6,13H2,1H3/b26-15+ |
| InChIKey | QXJSINYVNUERIK-CVKSISIWSA-N |
| XLogP | 4.43 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|