C46H58N2O7 — CID 177476495
[4-[(E)-[[4-[(4-decoxyphenyl)methoxy]benzoyl]hydrazinylidene]methyl]-3-hydroxyphenyl] 4-octoxybenzoate (PubChem CID 177476495) has the molecular formula C46H58N2O7 and a molecular weight of 750.98 g/mol. Its IUPAC name is [4-[(E)-[[4-[(4-decoxyphenyl)methoxy]benzoyl]hydrazinylidene]methyl]-3-hydroxyphenyl] 4-octoxybenzoate.
| Compound Name | [4-[(E)-[[4-[(4-decoxyphenyl)methoxy]benzoyl]hydrazinylidene]methyl]-3-hydroxyphenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 177476495 |
| Molecular Formula | C46H58N2O7 |
| Molecular Weight | 750.98 g/mol |
| Exact Mass | 750.42 |
| IUPAC Name | [4-[(E)-[[4-[(4-decoxyphenyl)methoxy]benzoyl]hydrazinylidene]methyl]-3-hydroxyphenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(COc2ccc(C(=O)N/N=C/c3ccc(OC(=O)c4ccc(OCCCCCCCC)cc4)cc3O)cc2)cc1 |
| InChI | InChI=1S/C46H58N2O7/c1-3-5-7-9-11-12-14-16-31-52-40-24-17-36(18-25-40)35-54-42-26-19-37(20-27-42)45(50)48-47-34-39-23-30-43(33-44(39)49)55-46(51)38-21-28-41(29-22-38)53-32-15-13-10-8-6-4-2/h17-30,33-34,49H,3-16,31-32,35H2,1-2H3,(H,48,50)/b47-34+ |
| InChIKey | HXINQCIVXVYYIX-BKFSTLNTSA-N |
| XLogP | 11.21 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.98 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|