C27H29N3O4 — CID 135876991
[3-hydroxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-heptylbenzoate (PubChem CID 135876991) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [3-hydroxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-heptylbenzoate.
| Compound Name | [3-hydroxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-heptylbenzoate |
|---|---|
| PubChem CID | 135876991 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [3-hydroxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc(/C=N/NC(=O)c3ccncc3)c(O)c2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-2-3-4-5-6-7-20-8-10-22(11-9-20)27(33)34-24-13-12-23(25(31)18-24)19-29-30-26(32)21-14-16-28-17-15-21/h8-19,31H,2-7H2,1H3,(H,30,32)/b29-19+ |
| InChIKey | KAAZESZJBINOII-VUTHCHCSSA-N |
| XLogP | 5.28 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|