(4-pentylphenyl) pyridine-4-carboxylate

C17H19NO2 — CID 4683685

IUPAC(4-pentylphenyl) pyridine-4-carboxylate
SMILESCCCCCc1ccc(OC(=O)c2ccncc2)cc1
InChIInChI=1S/C17H19NO2/c1-2-3-4-5-14-6-8-16(9-7-14)20-17(19)15-10-12-18-13-11-15/h6-13H,2-5H2,1H3
InChIKeyPGRHNXHDIWLQSQ-UHFFFAOYSA-N
MW269.34 g/mol
LogP4.03
Rot. Bonds6

About (4-pentylphenyl) pyridine-4-carboxylate

(4-pentylphenyl) pyridine-4-carboxylate (PubChem CID 4683685) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (4-pentylphenyl) pyridine-4-carboxylate.

Molecular Properties

Compound Name(4-pentylphenyl) pyridine-4-carboxylate
PubChem CID4683685
Molecular FormulaC17H19NO2
Molecular Weight269.34 g/mol
Exact Mass269.14
IUPAC Name(4-pentylphenyl) pyridine-4-carboxylate
SMILESCCCCCc1ccc(OC(=O)c2ccncc2)cc1
InChIInChI=1S/C17H19NO2/c1-2-3-4-5-14-6-8-16(9-7-14)20-17(19)15-10-12-18-13-11-15/h6-13H,2-5H2,1H3
InChIKeyPGRHNXHDIWLQSQ-UHFFFAOYSA-N
XLogP4.03
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 54.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-pentylphenyl) pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-pentylphenyl) pyridine-4-carboxylate?
The IUPAC name of (4-pentylphenyl) pyridine-4-carboxylate (CID 4683685) is (4-pentylphenyl) pyridine-4-carboxylate.
What is the SMILES notation for (4-pentylphenyl) pyridine-4-carboxylate?
The canonical SMILES for (4-pentylphenyl) pyridine-4-carboxylate is CCCCCc1ccc(OC(=O)c2ccncc2)cc1.
What is the InChIKey of (4-pentylphenyl) pyridine-4-carboxylate?
The InChIKey is PGRHNXHDIWLQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-3-4-5-14-6-8-16(9-7-14)20-17(19)15-10-12-18-13-11-15/h6-13H,2-5H2,1H3.
What are the key properties of (4-pentylphenyl) pyridine-4-carboxylate?
(4-pentylphenyl) pyridine-4-carboxylate has a molecular weight of 269.34 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylphenyl) pyridine-4-carboxylate is sourced from PubChem (CID 4683685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).