About (4-pentylphenyl) pyridine-4-carboxylate
(4-pentylphenyl) pyridine-4-carboxylate (PubChem CID 4683685) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (4-pentylphenyl) pyridine-4-carboxylate.
Molecular Properties
| Compound Name | (4-pentylphenyl) pyridine-4-carboxylate |
| PubChem CID | 4683685 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (4-pentylphenyl) pyridine-4-carboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C17H19NO2/c1-2-3-4-5-14-6-8-16(9-7-14)20-17(19)15-10-12-18-13-11-15/h6-13H,2-5H2,1H3 |
| InChIKey | PGRHNXHDIWLQSQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-pentylphenyl) pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentylphenyl) pyridine-4-carboxylate?
The IUPAC name of (4-pentylphenyl) pyridine-4-carboxylate (CID 4683685) is (4-pentylphenyl) pyridine-4-carboxylate.
What is the SMILES notation for (4-pentylphenyl) pyridine-4-carboxylate?
The canonical SMILES for (4-pentylphenyl) pyridine-4-carboxylate is CCCCCc1ccc(OC(=O)c2ccncc2)cc1.
What is the InChIKey of (4-pentylphenyl) pyridine-4-carboxylate?
The InChIKey is PGRHNXHDIWLQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-3-4-5-14-6-8-16(9-7-14)20-17(19)15-10-12-18-13-11-15/h6-13H,2-5H2,1H3.
What are the key properties of (4-pentylphenyl) pyridine-4-carboxylate?
(4-pentylphenyl) pyridine-4-carboxylate has a molecular weight of 269.34 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylphenyl) pyridine-4-carboxylate is sourced from PubChem (CID 4683685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).