C44H42O8 — CID 101117986
bis[4-(4-pentylphenoxy)carbonylphenyl] benzene-1,3-dicarboxylate (PubChem CID 101117986) has the molecular formula C44H42O8 and a molecular weight of 698.81 g/mol. Its IUPAC name is bis[4-(4-pentylphenoxy)carbonylphenyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[4-(4-pentylphenoxy)carbonylphenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101117986 |
| Molecular Formula | C44H42O8 |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | bis[4-(4-pentylphenoxy)carbonylphenyl] benzene-1,3-dicarboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3cccc(C(=O)Oc4ccc(C(=O)Oc5ccc(CCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C44H42O8/c1-3-5-7-10-31-14-22-37(23-15-31)49-41(45)33-18-26-39(27-19-33)51-43(47)35-12-9-13-36(30-35)44(48)52-40-28-20-34(21-29-40)42(46)50-38-24-16-32(17-25-38)11-8-6-4-2/h9,12-30H,3-8,10-11H2,1-2H3 |
| InChIKey | LKKNHRCPURJYMN-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|