C52H54O4 — CID 100960860
[4-[2-[3-[2-[4-(4-octylbenzoyl)oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-octylbenzoate (PubChem CID 100960860) has the molecular formula C52H54O4 and a molecular weight of 743.00 g/mol. Its IUPAC name is [4-[2-[3-[2-[4-(4-octylbenzoyl)oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-octylbenzoate.
| Compound Name | [4-[2-[3-[2-[4-(4-octylbenzoyl)oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-octylbenzoate |
|---|---|
| PubChem CID | 100960860 |
| Molecular Formula | C52H54O4 |
| Molecular Weight | 743.00 g/mol |
| Exact Mass | 742.40 |
| IUPAC Name | [4-[2-[3-[2-[4-(4-octylbenzoyl)oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-octylbenzoate |
| SMILES | CCCCCCCCc1ccc(C(=O)Oc2ccc(C#Cc3cccc(C#Cc4ccc(OC(=O)c5ccc(CCCCCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C52H54O4/c1-3-5-7-9-11-13-16-41-24-32-47(33-25-41)51(53)55-49-36-28-43(29-37-49)20-22-45-18-15-19-46(40-45)23-21-44-30-38-50(39-31-44)56-52(54)48-34-26-42(27-35-48)17-14-12-10-8-6-4-2/h15,18-19,24-40H,3-14,16-17H2,1-2H3 |
| InChIKey | XDQCGYFDDPSUHQ-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.00 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|