C60H58N4O4 — CID 100960859
[4-[2-[3-[2-[4-[4-(5-octylpyrimidin-2-yl)benzoyl]oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-(5-octylpyrimidin-2-yl)benzoate (PubChem CID 100960859) has the molecular formula C60H58N4O4 and a molecular weight of 899.15 g/mol. Its IUPAC name is [4-[2-[3-[2-[4-[4-(5-octylpyrimidin-2-yl)benzoyl]oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-(5-octylpyrimidin-2-yl)benzoate.
| Compound Name | [4-[2-[3-[2-[4-[4-(5-octylpyrimidin-2-yl)benzoyl]oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-(5-octylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 100960859 |
| Molecular Formula | C60H58N4O4 |
| Molecular Weight | 899.15 g/mol |
| Exact Mass | 898.45 |
| IUPAC Name | [4-[2-[3-[2-[4-[4-(5-octylpyrimidin-2-yl)benzoyl]oxyphenyl]ethynyl]phenyl]ethynyl]phenyl] 4-(5-octylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(C#Cc4cccc(C#Cc5ccc(OC(=O)c6ccc(-c7ncc(CCCCCCCC)cn7)cc6)cc5)c4)cc3)cc2)nc1 |
| InChI | InChI=1S/C60H58N4O4/c1-3-5-7-9-11-13-16-49-41-61-57(62-42-49)51-28-32-53(33-29-51)59(65)67-55-36-24-45(25-37-55)20-22-47-18-15-19-48(40-47)23-21-46-26-38-56(39-27-46)68-60(66)54-34-30-52(31-35-54)58-63-43-50(44-64-58)17-14-12-10-8-6-4-2/h15,18-19,24-44H,3-14,16-17H2,1-2H3 |
| InChIKey | AHFDXNZHQKIORY-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.15 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|