About [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate
[4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate (PubChem CID 21246962) has the molecular formula C29H35ClN2O2
and a molecular weight of 479.06 g/mol. Its IUPAC name is [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate.
Molecular Properties
| Compound Name | [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate |
| PubChem CID | 21246962 |
| Molecular Formula | C29H35ClN2O2 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate |
| SMILES | CCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCCCCC)c(Cl)c3)cc2)nc1 |
| InChI | InChI=1S/C29H35ClN2O2/c1-3-5-7-9-11-22-20-31-28(32-21-22)24-15-17-26(18-16-24)34-29(33)25-14-13-23(27(30)19-25)12-10-8-6-4-2/h13-21H,3-12H2,1-2H3 |
| InChIKey | VQVWSWRXGMRXGP-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate?
The IUPAC name of [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate (CID 21246962) is [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate.
What is the SMILES notation for [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate?
The canonical SMILES for [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate is CCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCCCCC)c(Cl)c3)cc2)nc1.
What is the InChIKey of [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate?
The InChIKey is VQVWSWRXGMRXGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H35ClN2O2/c1-3-5-7-9-11-22-20-31-28(32-21-22)24-15-17-26(18-16-24)34-29(33)25-14-13-23(27(30)19-25)12-10-8-6-4-2/h13-21H,3-12H2,1-2H3.
What are the key properties of [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate?
[4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate has a molecular weight of 479.06 g/mol, XLogP of 8.26, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-hexylpyrimidin-2-yl)phenyl] 3-chloro-4-hexylbenzoate is sourced from PubChem (CID 21246962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).