About [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate
[4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate (PubChem CID 21247003) has the molecular formula C28H33BrN2O2
and a molecular weight of 509.49 g/mol. Its IUPAC name is [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate.
Molecular Properties
| Compound Name | [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate |
| PubChem CID | 21247003 |
| Molecular Formula | C28H33BrN2O2 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate |
| SMILES | CCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCC)cn3)cc2)cc1Br |
| InChI | InChI=1S/C28H33BrN2O2/c1-3-5-7-9-11-22-12-13-24(18-26(22)29)28(32)33-25-16-14-23(15-17-25)27-30-19-21(20-31-27)10-8-6-4-2/h12-20H,3-11H2,1-2H3 |
| InChIKey | MGOGIUMUWARNPP-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate?
The IUPAC name of [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate (CID 21247003) is [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate.
What is the SMILES notation for [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate?
The canonical SMILES for [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate is CCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCC)cn3)cc2)cc1Br.
What is the InChIKey of [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate?
The InChIKey is MGOGIUMUWARNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33BrN2O2/c1-3-5-7-9-11-22-12-13-24(18-26(22)29)28(32)33-25-16-14-23(15-17-25)27-30-19-21(20-31-27)10-8-6-4-2/h12-20H,3-11H2,1-2H3.
What are the key properties of [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate?
[4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate has a molecular weight of 509.49 g/mol, XLogP of 7.98, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-pentylpyrimidin-2-yl)phenyl] 3-bromo-4-hexylbenzoate is sourced from PubChem (CID 21247003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).