About [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate
[4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate (PubChem CID 21247058) has the molecular formula C34H43N3O2
and a molecular weight of 525.74 g/mol. Its IUPAC name is [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate.
Molecular Properties
| Compound Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate |
| PubChem CID | 21247058 |
| Molecular Formula | C34H43N3O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate |
| SMILES | CCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCC)cn3)cc2)cc1C#N |
| InChI | InChI=1S/C34H43N3O2/c1-3-5-7-9-10-12-14-16-28-17-18-30(23-31(28)24-35)34(38)39-32-21-19-29(20-22-32)33-36-25-27(26-37-33)15-13-11-8-6-4-2/h17-23,25-26H,3-16H2,1-2H3 |
| InChIKey | YIHKSDVHTJHCNH-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate?
The IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate (CID 21247058) is [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate.
What is the SMILES notation for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate?
The canonical SMILES for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate is CCCCCCCCCc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCC)cn3)cc2)cc1C#N.
What is the InChIKey of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate?
The InChIKey is YIHKSDVHTJHCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H43N3O2/c1-3-5-7-9-10-12-14-16-28-17-18-30(23-31(28)24-35)34(38)39-32-21-19-29(20-22-32)33-36-25-27(26-37-33)15-13-11-8-6-4-2/h17-23,25-26H,3-16H2,1-2H3.
What are the key properties of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate?
[4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate has a molecular weight of 525.74 g/mol, XLogP of 9.04, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-cyano-4-nonylbenzoate is sourced from PubChem (CID 21247058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).