About (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate
(2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate (PubChem CID 54011730) has the molecular formula C36H47N3O2
and a molecular weight of 553.79 g/mol. Its IUPAC name is (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate.
Molecular Properties
| Compound Name | (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate |
| PubChem CID | 54011730 |
| Molecular Formula | C36H47N3O2 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCCCc1ccc(OC(=O)c2ccc(-c3ncc(CCCCCCCC)cn3)cc2)c(C#N)c1 |
| InChI | InChI=1S/C36H47N3O2/c1-3-5-7-9-11-12-14-15-17-29-19-24-34(33(25-29)26-37)41-36(40)32-22-20-31(21-23-32)35-38-27-30(28-39-35)18-16-13-10-8-6-4-2/h19-25,27-28H,3-18H2,1-2H3 |
| InChIKey | KSVKRDABCOFMBH-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate?
The IUPAC name of (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate (CID 54011730) is (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate.
What is the SMILES notation for (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate?
The canonical SMILES for (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate is CCCCCCCCCCc1ccc(OC(=O)c2ccc(-c3ncc(CCCCCCCC)cn3)cc2)c(C#N)c1.
What is the InChIKey of (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate?
The InChIKey is KSVKRDABCOFMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H47N3O2/c1-3-5-7-9-11-12-14-15-17-29-19-24-34(33(25-29)26-37)41-36(40)32-22-20-31(21-23-32)35-38-27-30(28-39-35)18-16-13-10-8-6-4-2/h19-25,27-28H,3-18H2,1-2H3.
What are the key properties of (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate?
(2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate has a molecular weight of 553.79 g/mol, XLogP of 9.82, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-4-decylphenyl) 4-(5-octylpyrimidin-2-yl)benzoate is sourced from PubChem (CID 54011730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).