About (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate
(2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate (PubChem CID 54516684) has the molecular formula C31H35NO2
and a molecular weight of 453.63 g/mol. Its IUPAC name is (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate.
Molecular Properties
| Compound Name | (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate |
| PubChem CID | 54516684 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(CCCCC)cc3C#N)cc2)cc1 |
| InChI | InChI=1S/C31H35NO2/c1-3-5-7-9-10-24-12-15-26(16-13-24)27-17-19-28(20-18-27)31(33)34-30-21-14-25(11-8-6-4-2)22-29(30)23-32/h12-22H,3-11H2,1-2H3 |
| InChIKey | YMXDGDTUIKAHGB-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate?
The IUPAC name of (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate (CID 54516684) is (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate.
What is the SMILES notation for (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate?
The canonical SMILES for (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate is CCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(CCCCC)cc3C#N)cc2)cc1.
What is the InChIKey of (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate?
The InChIKey is YMXDGDTUIKAHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H35NO2/c1-3-5-7-9-10-24-12-15-26(16-13-24)27-17-19-28(20-18-27)31(33)34-30-21-14-25(11-8-6-4-2)22-29(30)23-32/h12-22H,3-11H2,1-2H3.
What are the key properties of (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate?
(2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate has a molecular weight of 453.63 g/mol, XLogP of 8.30, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-4-pentylphenyl) 4-(4-hexylphenyl)benzoate is sourced from PubChem (CID 54516684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).