About (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate
(4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate (PubChem CID 14474366) has the molecular formula C37H47NO3
and a molecular weight of 553.79 g/mol. Its IUPAC name is (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate.
Molecular Properties
| Compound Name | (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate |
| PubChem CID | 14474366 |
| Molecular Formula | C37H47NO3 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate |
| SMILES | CCCCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCC[C@@H](C)CC)c(C#N)c3)cc2)cc1 |
| InChI | InChI=1S/C37H47NO3/c1-4-6-7-8-9-12-15-30-16-23-35(24-17-30)41-37(39)32-20-18-31(19-21-32)33-22-25-36(34(27-33)28-38)40-26-13-10-11-14-29(3)5-2/h16-25,27,29H,4-15,26H2,1-3H3/t29-/m0/s1 |
| InChIKey | BURKEFVPIISAMW-LJAQVGFWSA-N |
| XLogP | 10.33 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate?
The IUPAC name of (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate (CID 14474366) is (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate.
What is the SMILES notation for (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate?
The canonical SMILES for (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate is CCCCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCC[C@@H](C)CC)c(C#N)c3)cc2)cc1.
What is the InChIKey of (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate?
The InChIKey is BURKEFVPIISAMW-LJAQVGFWSA-N. The full InChI is InChI=1S/C37H47NO3/c1-4-6-7-8-9-12-15-30-16-23-35(24-17-30)41-37(39)32-20-18-31(19-21-32)33-22-25-36(34(27-33)28-38)40-26-13-10-11-14-29(3)5-2/h16-25,27,29H,4-15,26H2,1-3H3/t29-/m0/s1.
What are the key properties of (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate?
(4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate has a molecular weight of 553.79 g/mol, XLogP of 10.33, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-octylphenyl) 4-[3-cyano-4-[(6S)-6-methyloctoxy]phenyl]benzoate is sourced from PubChem (CID 14474366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).