About (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate
(2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate (PubChem CID 54042833) has the molecular formula C34H41NO2
and a molecular weight of 495.71 g/mol. Its IUPAC name is (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate.
Molecular Properties
| Compound Name | (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate |
| PubChem CID | 54042833 |
| Molecular Formula | C34H41NO2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate |
| SMILES | CCCCCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(CC(C)CC)cc3)cc2)c(C#N)c1 |
| InChI | InChI=1S/C34H41NO2/c1-4-6-7-8-9-10-11-12-27-15-22-33(32(24-27)25-35)37-34(36)31-20-18-30(19-21-31)29-16-13-28(14-17-29)23-26(3)5-2/h13-22,24,26H,4-12,23H2,1-3H3 |
| InChIKey | LNNUAJMWJGZUIU-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate?
The IUPAC name of (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate (CID 54042833) is (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate.
What is the SMILES notation for (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate?
The canonical SMILES for (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate is CCCCCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(CC(C)CC)cc3)cc2)c(C#N)c1.
What is the InChIKey of (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate?
The InChIKey is LNNUAJMWJGZUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H41NO2/c1-4-6-7-8-9-10-11-12-27-15-22-33(32(24-27)25-35)37-34(36)31-20-18-30(19-21-31)29-16-13-28(14-17-29)23-26(3)5-2/h13-22,24,26H,4-12,23H2,1-3H3.
What are the key properties of (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate?
(2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate has a molecular weight of 495.71 g/mol, XLogP of 9.33, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-4-nonylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate is sourced from PubChem (CID 54042833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).