C27H27NO2 — CID 161279208
(4-cyano-2,5-dimethylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate (PubChem CID 161279208) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (4-cyano-2,5-dimethylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate.
| Compound Name | (4-cyano-2,5-dimethylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate |
|---|---|
| PubChem CID | 161279208 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (4-cyano-2,5-dimethylphenyl) 4-[4-(2-methylbutyl)phenyl]benzoate |
| SMILES | CCC(C)Cc1ccc(-c2ccc(C(=O)Oc3cc(C)c(C#N)cc3C)cc2)cc1 |
| InChI | InChI=1S/C27H27NO2/c1-5-18(2)14-21-6-8-22(9-7-21)23-10-12-24(13-11-23)27(29)30-26-16-19(3)25(17-28)15-20(26)4/h6-13,15-16,18H,5,14H2,1-4H3 |
| InChIKey | NVACCQSUCCMLHM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|