C28H28O4 — CID 58309149
[4-[4-(2-methylbutyl)phenyl]phenyl] 4-(prop-2-enoyloxymethyl)benzoate (PubChem CID 58309149) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is [4-[4-(2-methylbutyl)phenyl]phenyl] 4-(prop-2-enoyloxymethyl)benzoate.
| Compound Name | [4-[4-(2-methylbutyl)phenyl]phenyl] 4-(prop-2-enoyloxymethyl)benzoate |
|---|---|
| PubChem CID | 58309149 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [4-[4-(2-methylbutyl)phenyl]phenyl] 4-(prop-2-enoyloxymethyl)benzoate |
| SMILES | C=CC(=O)OCc1ccc(C(=O)Oc2ccc(-c3ccc(CC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H28O4/c1-4-20(3)18-21-6-10-23(11-7-21)24-14-16-26(17-15-24)32-28(30)25-12-8-22(9-13-25)19-31-27(29)5-2/h5-17,20H,2,4,18-19H2,1,3H3 |
| InChIKey | RYSGPKWIDAIOON-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|