C25H24O5 — CID 143049995
[4-[4-(2-methylbutyl)phenoxy]carbonylphenyl] 4-hydroxybenzoate (PubChem CID 143049995) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is [4-[4-(2-methylbutyl)phenoxy]carbonylphenyl] 4-hydroxybenzoate.
| Compound Name | [4-[4-(2-methylbutyl)phenoxy]carbonylphenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 143049995 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [4-[4-(2-methylbutyl)phenoxy]carbonylphenyl] 4-hydroxybenzoate |
| SMILES | CCC(C)Cc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H24O5/c1-3-17(2)16-18-4-12-22(13-5-18)29-25(28)20-8-14-23(15-9-20)30-24(27)19-6-10-21(26)11-7-19/h4-15,17,26H,3,16H2,1-2H3 |
| InChIKey | LSTRQIQPCNDUAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|