C20H23ClO2 — CID 23597760
[4-(2-methylbutyl)phenyl] 2-chloro-4-ethylbenzoate (PubChem CID 23597760) has the molecular formula C20H23ClO2 and a molecular weight of 330.86 g/mol. Its IUPAC name is [4-(2-methylbutyl)phenyl] 2-chloro-4-ethylbenzoate.
| Compound Name | [4-(2-methylbutyl)phenyl] 2-chloro-4-ethylbenzoate |
|---|---|
| PubChem CID | 23597760 |
| Molecular Formula | C20H23ClO2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [4-(2-methylbutyl)phenyl] 2-chloro-4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(CC(C)CC)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClO2/c1-4-14(3)12-16-6-9-17(10-7-16)23-20(22)18-11-8-15(5-2)13-19(18)21/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | DAOPXEMEBWQMIG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|