C67H80Cl2O8 — CID 158297461
(4-decylphenyl) 2-chloro-4-(4-heptylbenzoyl)oxybenzoate;(4-pentylphenyl) 2-chloro-4-(4-pentylbenzoyl)oxybenzoate (PubChem CID 158297461) has the molecular formula C67H80Cl2O8 and a molecular weight of 1084.27 g/mol. Its IUPAC name is (4-decylphenyl) 2-chloro-4-(4-heptylbenzoyl)oxybenzoate;(4-pentylphenyl) 2-chloro-4-(4-pentylbenzoyl)oxybenzoate.
| Compound Name | (4-decylphenyl) 2-chloro-4-(4-heptylbenzoyl)oxybenzoate;(4-pentylphenyl) 2-chloro-4-(4-pentylbenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 158297461 |
| Molecular Formula | C67H80Cl2O8 |
| Molecular Weight | 1084.27 g/mol |
| Exact Mass | 1082.52 |
| IUPAC Name | (4-decylphenyl) 2-chloro-4-(4-heptylbenzoyl)oxybenzoate;(4-pentylphenyl) 2-chloro-4-(4-pentylbenzoyl)oxybenzoate |
| SMILES | CCCCCCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(CCCCCCC)cc3)cc2Cl)cc1.CCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(CCCCC)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C37H47ClO4.C30H33ClO4/c1-3-5-7-9-10-11-13-15-17-30-20-24-32(25-21-30)41-37(40)34-27-26-33(28-35(34)38)42-36(39)31-22-18-29(19-23-31)16-14-12-8-6-4-2;1-3-5-7-9-22-11-15-24(16-12-22)29(32)35-26-19-20-27(28(31)21-26)30(33)34-25-17-13-23(14-18-25)10-8-6-4-2/h18-28H,3-17H2,1-2H3;11-21H,3-10H2,1-2H3 |
| InChIKey | GMBWFTPCNWKGPL-UHFFFAOYSA-N |
| XLogP | 19.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1084.27 |
| LogP ≤ 5 | 19.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|