C28H27ClO4 — CID 70559463
2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylbenzoyl)oxybenzoate (PubChem CID 70559463) has the molecular formula C28H27ClO4 and a molecular weight of 462.97 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylbenzoyl)oxybenzoate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylbenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 70559463 |
| Molecular Formula | C28H27ClO4 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylbenzoyl)oxybenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(C(=O)OC3Cc4ccccc4C3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H27ClO4/c1-2-3-4-7-19-10-12-20(13-11-19)27(30)32-23-14-15-25(26(29)18-23)28(31)33-24-16-21-8-5-6-9-22(21)17-24/h5-6,8-15,18,24H,2-4,7,16-17H2,1H3 |
| InChIKey | JBFSYHOWXIVPND-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|