C38H33ClN2O4 — CID 88641237
[4-(1,1-dicyanoprop-1-en-2-yl)phenyl] 2-chloro-4-[4-(4-heptylphenyl)benzoyl]oxybenzoate (PubChem CID 88641237) has the molecular formula C38H33ClN2O4 and a molecular weight of 617.15 g/mol. Its IUPAC name is [4-(1,1-dicyanoprop-1-en-2-yl)phenyl] 2-chloro-4-[4-(4-heptylphenyl)benzoyl]oxybenzoate.
| Compound Name | [4-(1,1-dicyanoprop-1-en-2-yl)phenyl] 2-chloro-4-[4-(4-heptylphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 88641237 |
| Molecular Formula | C38H33ClN2O4 |
| Molecular Weight | 617.15 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | [4-(1,1-dicyanoprop-1-en-2-yl)phenyl] 2-chloro-4-[4-(4-heptylphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)Oc4ccc(C(C)=C(C#N)C#N)cc4)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C38H33ClN2O4/c1-3-4-5-6-7-8-27-9-11-29(12-10-27)30-13-15-31(16-14-30)37(42)45-34-21-22-35(36(39)23-34)38(43)44-33-19-17-28(18-20-33)26(2)32(24-40)25-41/h9-23H,3-8H2,1-2H3 |
| InChIKey | PCIDUGNYRJJBHQ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.15 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|