C26H25ClO4 — CID 21285333
2-chloro-4-[4-(4-hexylphenyl)benzoyl]oxybenzoic acid (PubChem CID 21285333) has the molecular formula C26H25ClO4 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-chloro-4-[4-(4-hexylphenyl)benzoyl]oxybenzoic acid.
| Compound Name | 2-chloro-4-[4-(4-hexylphenyl)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 21285333 |
| Molecular Formula | C26H25ClO4 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-chloro-4-[4-(4-hexylphenyl)benzoyl]oxybenzoic acid |
| SMILES | CCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C26H25ClO4/c1-2-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)26(30)31-22-15-16-23(25(28)29)24(27)17-22/h7-17H,2-6H2,1H3,(H,28,29) |
| InChIKey | WQPMJIPRBFHWDZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|