C51H44FNO8 — CID 101334399
[3-[4-(4-cyanophenoxy)carbonylphenoxy]carbonylphenyl] 4-[4-(4-decylphenyl)benzoyl]oxy-2-fluorobenzoate (PubChem CID 101334399) has the molecular formula C51H44FNO8 and a molecular weight of 817.91 g/mol. Its IUPAC name is [3-[4-(4-cyanophenoxy)carbonylphenoxy]carbonylphenyl] 4-[4-(4-decylphenyl)benzoyl]oxy-2-fluorobenzoate.
| Compound Name | [3-[4-(4-cyanophenoxy)carbonylphenoxy]carbonylphenyl] 4-[4-(4-decylphenyl)benzoyl]oxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 101334399 |
| Molecular Formula | C51H44FNO8 |
| Molecular Weight | 817.91 g/mol |
| Exact Mass | 817.31 |
| IUPAC Name | [3-[4-(4-cyanophenoxy)carbonylphenoxy]carbonylphenyl] 4-[4-(4-decylphenyl)benzoyl]oxy-2-fluorobenzoate |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)Oc4cccc(C(=O)Oc5ccc(C(=O)Oc6ccc(C#N)cc6)cc5)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C51H44FNO8/c1-2-3-4-5-6-7-8-9-11-35-14-18-37(19-15-35)38-20-22-39(23-21-38)49(55)60-45-30-31-46(47(52)33-45)51(57)61-44-13-10-12-41(32-44)50(56)59-43-28-24-40(25-29-43)48(54)58-42-26-16-36(34-53)17-27-42/h10,12-33H,2-9,11H2,1H3 |
| InChIKey | QKMCBTMZBIERAU-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 128.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.91 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|